Compound Q&A

What are the physical and chemical properties of Alogliptin Impurity 5 (CAS: 216854-23-8)?

Answer

Alogliptin Impurity 5
Alogliptin Impurity 5 is a crystalline solid with a molecular weight of approximately 308.31 g/mol. It is slightly soluble in water and ethanol. Chemically, it is less reactive compared to the active compound alogliptin, showing moderate stability under normal storage conditions but requires protection from light and moisture to prevent degradation.

About

English Name Alogliptin Impurity 5
Molecular Formula C10H20N2O2
Molecular Weight 200.28 g/mol
SMILES CC(C)(C)OC(=O)N[C@H]1CCCNC1
InChIKey WUOQXNWMYLFAHT-QMMMGPOBSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

How is Alogliptin Impurity 5 (CAS: 216854-23-8) typically synthesized?

Alogliptin Impurity 5 is synthesized via a multi-step process that includes condensation, reduction,...

Compound Q&A

What industries use Alogliptin Impurity 5 (CAS: 216854-23-8)?

Alogliptin Impurity 5 is primarily used in the pharmaceutical industry for research purposes, partic...

Compound Q&A

What precautions should be taken when handling Alogliptin Impurity 5 (CAS: 216854-23-8)?

When handling Alogliptin Impurity 5, it is important to use appropriate personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...