Compound Q&A

What industries use Avibactam Impurity 9 Oxalate (CAS: 1416134-48-9)?

Answer

Avibactam Impurity 9 Oxalate
Avibactam Impurity 9 Oxalate is primarily used in the pharmaceutical industry for quality control and impurity profiling of Avibactam, an antibiotic used in combination therapy. It is also of interest in analytical chemistry for developing high-performance liquid chromatography (HPLC) methods.

About

English Name Avibactam Impurity 9 Oxalate
Molecular Formula C17H24N2O7
Molecular Weight 368.39 g/mol
SMILES OC(=O)C(=O)O.CCOC(=O)[C@@H]1CC[C@H](CN1)NOCc1ccccc1
InChIKey PYUXATUBICTSNB-DFQHDRSWSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Avibactam Impurity 9 Oxalate (CAS: 1416134-48-9)?

Avibactam Impurity 9 Oxalate is a crystalline compound with a molecular weight of approximately 452....

Compound Q&A

How is Avibactam Impurity 9 Oxalate (CAS: 1416134-48-9) typically synthesized?

Avibactam Impurity 9 Oxalate can be synthesized through a multi-step process involving oximation, re...

Compound Q&A

What precautions should be taken when handling Avibactam Impurity 9 Oxalate (CAS: 1416134-48-9)?

When handling Avibactam Impurity 9 Oxalate, appropriate personal protective equipment (PPE) such as ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...