Compound Q&A

How is Avibactam Impurity 9 Oxalate (CAS: 1416134-48-9) typically synthesized?

Answer

Avibactam Impurity 9 Oxalate
Avibactam Impurity 9 Oxalate can be synthesized through a multi-step process involving oximation, reduction, and oxalate formation. The synthesis typically requires a catalyst such as palladium on carbon and is characterized by good yield and selectivity.

About

English Name Avibactam Impurity 9 Oxalate
Molecular Formula C17H24N2O7
Molecular Weight 368.39 g/mol
SMILES OC(=O)C(=O)O.CCOC(=O)[C@@H]1CC[C@H](CN1)NOCc1ccccc1
InChIKey PYUXATUBICTSNB-DFQHDRSWSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Avibactam Impurity 9 Oxalate (CAS: 1416134-48-9)?

Avibactam Impurity 9 Oxalate is a crystalline compound with a molecular weight of approximately 452....

Compound Q&A

What industries use Avibactam Impurity 9 Oxalate (CAS: 1416134-48-9)?

Avibactam Impurity 9 Oxalate is primarily used in the pharmaceutical industry for quality control an...

Compound Q&A

What precautions should be taken when handling Avibactam Impurity 9 Oxalate (CAS: 1416134-48-9)?

When handling Avibactam Impurity 9 Oxalate, appropriate personal protective equipment (PPE) such as ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...