Compound Q&A

What industries use N,N'-Diphenylcarbamimidic acid (CAS: 102-07-8)?

Answer

N,N'-Diphenylcarbamimidic acid
N,N'-Diphenylcarbamimidic acid finds applications in various industries. It is used in the synthesis of pharmaceuticals, particularly in the development of certain drugs. It is also utilized in the preparation of polymers and is important in the production of sensors and semiconductors due to its unique chemical properties.

About

CAS No 102-07-8
English Name N,N'-Diphenylcarbamimidic acid
Molecular Formula C13H12N2O
Molecular Weight 212.25 g/mol
SMILES C1=CC=C(C=C1)NC(=O)NC2=CC=CC=C2
InChIKey GWEHVDNNLFDJLR-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N'-Diphenylcarbamimidic acid (CAS: 102-07-8)?

N,N'-Diphenylcarbamimidic acid is a white crystalline solid with a molecular weight of 212.22 g/mol....

Compound Q&A

How is N,N'-Diphenylcarbamimidic acid (CAS: 102-07-8) typically synthesized?

N,N'-Diphenylcarbamimidic acid is typically synthesized by the reaction of diphenylurea with phospho...

Compound Q&A

What precautions should be taken when handling N,N'-Diphenylcarbamimidic acid (CAS: 102-07-8)?

When handling N,N'-Diphenylcarbamimidic acid, it is crucial to use proper personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...