Compound Q&A

How is N,N'-Diphenylcarbamimidic acid (CAS: 102-07-8) typically synthesized?

Answer

N,N'-Diphenylcarbamimidic acid
N,N'-Diphenylcarbamimidic acid is typically synthesized by the reaction of diphenylurea with phosphorus oxychloride in the presence of a base. The yield is usually high, around 80-90%, and the reaction is conducted at ambient temperature. The process is selective and yields a pure product with good purity.

About

CAS No 102-07-8
English Name N,N'-Diphenylcarbamimidic acid
Molecular Formula C13H12N2O
Molecular Weight 212.25 g/mol
SMILES C1=CC=C(C=C1)NC(=O)NC2=CC=CC=C2
InChIKey GWEHVDNNLFDJLR-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N'-Diphenylcarbamimidic acid (CAS: 102-07-8)?

N,N'-Diphenylcarbamimidic acid is a white crystalline solid with a molecular weight of 212.22 g/mol....

Compound Q&A

What industries use N,N'-Diphenylcarbamimidic acid (CAS: 102-07-8)?

N,N'-Diphenylcarbamimidic acid finds applications in various industries. It is used in the synthesis...

Compound Q&A

What precautions should be taken when handling N,N'-Diphenylcarbamimidic acid (CAS: 102-07-8)?

When handling N,N'-Diphenylcarbamimidic acid, it is crucial to use proper personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...