Compound Q&A

How is (2R,3R,4S)-2,3,4-Trihydroxy-5-oxohexane-1,6-diyl bis(dihydrogen phosphate) (CAS: 488-69-7) typically synthesized?

Answer

(2R,3R,4S)-2,3,4-Trihydroxy-5-oxohexane-1,6-diyl bis(dihydrogen phosphate)
This compound is typically synthesized through a multi-step process involving the condensation of diols with phosgene followed by hydrolysis. The reaction is catalyzed by an organic base and proceeds under mild conditions. The yield is around 75-85%, and the process requires careful control of pH and temperature to achieve the desired stereoisomer.

About

CAS No 488-69-7
English Name (2R,3R,4S)-2,3,4-Trihydroxy-5-oxohexane-1,6-diyl bis(dihydrogen phosphate)
Molecular Formula C6H14O12P2
Molecular Weight 340.11 g/mol
SMILES C(C1C(C(C(O1)(COP(=O)(O)O)O)O)O)OP(=O)(O)O
InChIKey XPYBSIWDXQFNMH-UYFOZJQFSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R,3R,4S)-2,3,4-Trihydroxy-5-oxohexane-1,6-diyl bis(dihydrogen phosphate) (CAS: 488-69-7)?

The compound (2R,3R,4S)-2,3,4-Trihydroxy-5-oxohexane-1,6-diyl bis(dihydrogen phosphate) is a crystal...

Compound Q&A

What industries use (2R,3R,4S)-2,3,4-Trihydroxy-5-oxohexane-1,6-diyl bis(dihydrogen phosphate) (CAS: 488-69-7)?

This compound is used in a variety of industries, including pharmaceuticals, where it serves as a pr...

Compound Q&A

What precautions should be taken when handling (2R,3R,4S)-2,3,4-Trihydroxy-5-oxohexane-1,6-diyl bis(dihydrogen phosphate) (CAS: 488-69-7)?

When handling (2R,3R,4S)-2,3,4-Trihydroxy-5-oxohexane-1,6-diyl bis(dihydrogen phosphate), it is esse...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...