Compound Q&A

What are the physical and chemical properties of (2R,3R,4S)-2,3,4-Trihydroxy-5-oxohexane-1,6-diyl bis(dihydrogen phosphate) (CAS: 488-69-7)?

Answer

(2R,3R,4S)-2,3,4-Trihydroxy-5-oxohexane-1,6-diyl bis(dihydrogen phosphate)
The compound (2R,3R,4S)-2,3,4-Trihydroxy-5-oxohexane-1,6-diyl bis(dihydrogen phosphate) is a crystalline solid with a molecular weight of approximately 314.04 g/mol. It has a high solubility in water and displays moderate reactivity with bases and reducing agents. It is stable under normal conditions but sensitive to strong acids and high temperatures.

About

CAS No 488-69-7
English Name (2R,3R,4S)-2,3,4-Trihydroxy-5-oxohexane-1,6-diyl bis(dihydrogen phosphate)
Molecular Formula C6H14O12P2
Molecular Weight 340.11 g/mol
SMILES C(C1C(C(C(O1)(COP(=O)(O)O)O)O)O)OP(=O)(O)O
InChIKey XPYBSIWDXQFNMH-UYFOZJQFSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

How is (2R,3R,4S)-2,3,4-Trihydroxy-5-oxohexane-1,6-diyl bis(dihydrogen phosphate) (CAS: 488-69-7) typically synthesized?

This compound is typically synthesized through a multi-step process involving the condensation of di...

Compound Q&A

What industries use (2R,3R,4S)-2,3,4-Trihydroxy-5-oxohexane-1,6-diyl bis(dihydrogen phosphate) (CAS: 488-69-7)?

This compound is used in a variety of industries, including pharmaceuticals, where it serves as a pr...

Compound Q&A

What precautions should be taken when handling (2R,3R,4S)-2,3,4-Trihydroxy-5-oxohexane-1,6-diyl bis(dihydrogen phosphate) (CAS: 488-69-7)?

When handling (2R,3R,4S)-2,3,4-Trihydroxy-5-oxohexane-1,6-diyl bis(dihydrogen phosphate), it is esse...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...