Compound Q&A

What industries use Methylenebis(diphenylphosphine) (CAS: 2071-20-7)?

Answer

Methylenebis(diphenylphosphine)
Methylenebis(diphenylphosphine) is primarily used in the pharmaceutical industry for ligand applications in transition metal catalysis, particularly in C-H bond activation reactions. It is also used in the polymer industry for the synthesis of functional polymers and in the semiconductor industry for the deposition of phosphorus-doped films. Additionally, it finds applications in the production of sensors and as a ligand in various chemical reactions.

About

CAS No 2071-20-7
English Name Methylenebis(diphenylphosphine)
Molecular Formula C25H22P2
Molecular Weight 384.4 g/mol
SMILES C1=CC=C(C=C1)P(CP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4
InChIKey XGCDBGRZEKYHNV-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methylenebis(diphenylphosphine) (CAS: 2071-20-7)?

Methylenebis(diphenylphosphine) is a colorless liquid with a molecular weight of approximately 308.2...

Compound Q&A

How is Methylenebis(diphenylphosphine) (CAS: 2071-20-7) typically synthesized?

Methylenebis(diphenylphosphine) is typically synthesized via the reaction of diphenylphosphine with ...

Compound Q&A

What precautions should be taken when handling Methylenebis(diphenylphosphine) (CAS: 2071-20-7)?

When handling Methylenebis(diphenylphosphine), it is crucial to wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...