Compound Q&A

What are the physical and chemical properties of Methylenebis(diphenylphosphine) (CAS: 2071-20-7)?

Answer

Methylenebis(diphenylphosphine)
Methylenebis(diphenylphosphine) is a colorless liquid with a molecular weight of approximately 308.27 g/mol. It has a low solubility in water but is soluble in common organic solvents such as ethanol and acetone. This compound is known for its reactivity towards metal complexes and is often used as a ligand in transition metal catalysis. Its crystalline form is not common, and it is typically used in its liquid state.

About

CAS No 2071-20-7
English Name Methylenebis(diphenylphosphine)
Molecular Formula C25H22P2
Molecular Weight 384.4 g/mol
SMILES C1=CC=C(C=C1)P(CP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4
InChIKey XGCDBGRZEKYHNV-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

How is Methylenebis(diphenylphosphine) (CAS: 2071-20-7) typically synthesized?

Methylenebis(diphenylphosphine) is typically synthesized via the reaction of diphenylphosphine with ...

Compound Q&A

What industries use Methylenebis(diphenylphosphine) (CAS: 2071-20-7)?

Methylenebis(diphenylphosphine) is primarily used in the pharmaceutical industry for ligand applicat...

Compound Q&A

What precautions should be taken when handling Methylenebis(diphenylphosphine) (CAS: 2071-20-7)?

When handling Methylenebis(diphenylphosphine), it is crucial to wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...