Compound Q&A

What are the physical and chemical properties of N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-threonine hydrate (CAS: 73731-37-0)?

Answer

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-threonine hydrate (1:1)
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-threonine hydrate (CAS: 73731-37-0) is a white crystalline powder with a molecular weight of approximately 525.45 g/mol. It is sparingly soluble in water and has a low reactivity under normal conditions. This compound is known for its stability and can be used in various organic synthesis reactions.

About

CAS No 73731-37-0
English Name N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-threonine hydrate (1:1)
Molecular Formula C19H21NO6
Molecular Weight 341.36300000000006 g/mol
SMILES CC(C(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)O
InChIKey CGNQPFAECJFQNV-NRNQBQMASA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

How is N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-threonine hydrate (CAS: 73731-37-0) typically synthesized?

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-threonine hydrate (CAS: 73731-37-0) is typically synthesized ...

Compound Q&A

What industries use N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-threonine hydrate (CAS: 73731-37-0)?

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-threonine hydrate (CAS: 73731-37-0) is primarily used in the ...

Compound Q&A

What precautions should be taken when handling N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-threonine hydrate (CAS: 73731-37-0)?

When handling N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-threonine hydrate (CAS: 73731-37-0), it is impo...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...