Compound Q&A

How is 2-Chloro-4-nitropyridine (CAS: 23056-36-2) typically synthesized?

Answer

2-Chloro-4-nitropyridine
2-Chloro-4-nitropyridine is typically synthesized via the nitration of 2-chloropyridine. The nitration reaction is performed in the presence of a strong acid like sulfuric acid, and the reaction is carried out at an elevated temperature. This method yields a product with high selectivity and good yield, making it a common industrial process for producing this compound.

About

CAS No 23056-36-2
English Name 2-Chloro-4-nitropyridine
Molecular Formula C5H3ClN2O2
Molecular Weight 158.54 g/mol
SMILES C1=CN=C(C=C1[N+](=O)[O-])Cl
InChIKey LIEPVGBDUYKPLC-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-4-nitropyridine (CAS: 23056-36-2)?

2-Chloro-4-nitropyridine is a crystalline solid with a molecular weight of 171.56 g/mol. It has a me...

Compound Q&A

What industries use 2-Chloro-4-nitropyridine (CAS: 23056-36-2)?

2-Chloro-4-nitropyridine is used in various industries, including pharmaceuticals, where it serves a...

Compound Q&A

What precautions should be taken when handling 2-Chloro-4-nitropyridine (CAS: 23056-36-2)?

When handling 2-Chloro-4-nitropyridine, it is essential to use appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...