Compound Q&A

What are the physical and chemical properties of 2-Chloro-4-nitropyridine (CAS: 23056-36-2)?

Answer

2-Chloro-4-nitropyridine
2-Chloro-4-nitropyridine is a crystalline solid with a molecular weight of 171.56 g/mol. It has a melting point of 150-152°C and is slightly soluble in water. This compound is moderately reactive, especially with reducing agents. It is an important intermediate in organic synthesis and exhibits good solubility in organic solvents like ethanol, acetone, and dichloromethane.

About

CAS No 23056-36-2
English Name 2-Chloro-4-nitropyridine
Molecular Formula C5H3ClN2O2
Molecular Weight 158.54 g/mol
SMILES C1=CN=C(C=C1[N+](=O)[O-])Cl
InChIKey LIEPVGBDUYKPLC-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

How is 2-Chloro-4-nitropyridine (CAS: 23056-36-2) typically synthesized?

2-Chloro-4-nitropyridine is typically synthesized via the nitration of 2-chloropyridine. The nitrati...

Compound Q&A

What industries use 2-Chloro-4-nitropyridine (CAS: 23056-36-2)?

2-Chloro-4-nitropyridine is used in various industries, including pharmaceuticals, where it serves a...

Compound Q&A

What precautions should be taken when handling 2-Chloro-4-nitropyridine (CAS: 23056-36-2)?

When handling 2-Chloro-4-nitropyridine, it is essential to use appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...