Compound Q&A

How is Solamargine (CAS: 20311-51-7) typically synthesized?

Answer

Solamargine
Solamargine (CAS: 20311-51-7) can be synthesized through a multi-step process involving condensation, ring closure, and deprotection reactions. Commonly, the total synthesis involves the use of Grignard reagents and transition metal catalysts. The yields are generally moderate to good, and the reaction selectivity is high, making the synthesis suitable for laboratory and industrial-scale production.

About

CAS No 20311-51-7
English Name Solamargine
Molecular Formula C45H73NO15
Molecular Weight 868.06 g/mol
SMILES OC[C@H]1O[C@@H](O[C@H]2CC[C@]3(C(=CC[C@@H]4[C@@H]3CC[C@]3([C@H]4C[C@H]4[C@@H]3[C@H](C)[C@]3(O4)CC[C@H](CN3)C)C)C2)C)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O
InChIKey MBWUSSKCCUMJHO-ZGXDEBHDSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Solamargine (CAS: 20311-51-7)?

Solamargine (CAS: 20311-51-7) is a white to off-white crystalline powder. Its molecular weight is ap...

Compound Q&A

What industries use Solamargine (CAS: 20311-51-7)?

Solamargine (CAS: 20311-51-7) is primarily used in the pharmaceutical industry for its potential ant...

Compound Q&A

What precautions should be taken when handling Solamargine (CAS: 20311-51-7)?

When handling Solamargine (CAS: 20311-51-7), it is important to use personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...