Compound Q&A

What are the physical and chemical properties of Solamargine (CAS: 20311-51-7)?

Answer

Solamargine
Solamargine (CAS: 20311-51-7) is a white to off-white crystalline powder. Its molecular weight is approximately 451.47 g/mol. It is slightly soluble in water and ethanol. Solamargine is relatively stable under normal conditions but may degrade when exposed to light and heat. It exhibits weak basicity and reacts with acids to form salts. Solamargine shows potential in natural product research and drug discovery.

About

CAS No 20311-51-7
English Name Solamargine
Molecular Formula C45H73NO15
Molecular Weight 868.06 g/mol
SMILES OC[C@H]1O[C@@H](O[C@H]2CC[C@]3(C(=CC[C@@H]4[C@@H]3CC[C@]3([C@H]4C[C@H]4[C@@H]3[C@H](C)[C@]3(O4)CC[C@H](CN3)C)C)C2)C)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O
InChIKey MBWUSSKCCUMJHO-ZGXDEBHDSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

How is Solamargine (CAS: 20311-51-7) typically synthesized?

Solamargine (CAS: 20311-51-7) can be synthesized through a multi-step process involving condensation...

Compound Q&A

What industries use Solamargine (CAS: 20311-51-7)?

Solamargine (CAS: 20311-51-7) is primarily used in the pharmaceutical industry for its potential ant...

Compound Q&A

What precautions should be taken when handling Solamargine (CAS: 20311-51-7)?

When handling Solamargine (CAS: 20311-51-7), it is important to use personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...