Compound Q&A

What precautions should be taken when handling 3-Phenylacrylic acid (CAS: 9045-22-1)?

Answer

3-Phenylacrylic acid
When handling 3-Phenylacrylic acid (CAS: 9045-22-1), it is essential to wear appropriate personal protective equipment (PPE), including gloves and eye protection. It should be stored in a sealed container and away from strong bases. In case of spillage, use a fume hood for safety. Refer to the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

About

CAS No 9045-22-1
English Name 3-Phenylacrylic acid
Molecular Formula C9H8O2
Molecular Weight 148.16 g/mol
SMILES COC1C(C(C(OC1C(=O)O)OC2C(OC(C(C2O)NS(=O)(=O)O)OC)COS(=O)(=O)O)OS(=O)(=O)O)O
InChIKey WBYWAXJHAXSJNI-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Phenylacrylic acid (CAS: 9045-22-1)?

3-Phenylacrylic acid (CAS: 9045-22-1) is a crystalline solid with a molecular weight of approximatel...

Compound Q&A

How is 3-Phenylacrylic acid (CAS: 9045-22-1) typically synthesized?

3-Phenylacrylic acid is typically synthesized via the Wittig reaction, where phenyl methyl ketone re...

Compound Q&A

What industries use 3-Phenylacrylic acid (CAS: 9045-22-1)?

3-Phenylacrylic acid (CAS: 9045-22-1) is used in various industries, including pharmaceuticals for t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...