Compound Q&A

How is 3-Phenylacrylic acid (CAS: 9045-22-1) typically synthesized?

Answer

3-Phenylacrylic acid
3-Phenylacrylic acid is typically synthesized via the Wittig reaction, where phenyl methyl ketone reacts with phosphorus ylide. Another method involves the condensation of benzaldehyde with acrylic acid, followed by hydrolysis. This process yields a pure product with high selectivity and good yield under appropriate conditions.

About

CAS No 9045-22-1
English Name 3-Phenylacrylic acid
Molecular Formula C9H8O2
Molecular Weight 148.16 g/mol
SMILES COC1C(C(C(OC1C(=O)O)OC2C(OC(C(C2O)NS(=O)(=O)O)OC)COS(=O)(=O)O)OS(=O)(=O)O)O
InChIKey WBYWAXJHAXSJNI-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Phenylacrylic acid (CAS: 9045-22-1)?

3-Phenylacrylic acid (CAS: 9045-22-1) is a crystalline solid with a molecular weight of approximatel...

Compound Q&A

What industries use 3-Phenylacrylic acid (CAS: 9045-22-1)?

3-Phenylacrylic acid (CAS: 9045-22-1) is used in various industries, including pharmaceuticals for t...

Compound Q&A

What precautions should be taken when handling 3-Phenylacrylic acid (CAS: 9045-22-1)?

When handling 3-Phenylacrylic acid (CAS: 9045-22-1), it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...