Compound Q&A

What industries use 8-Hydroxyquinoline-5-sulfonic acid (CAS: 84-88-8)?

Answer

8-Hydroxyquinoline-5-sulfonic acid
8-Hydroxyquinoline-5-sulfonic acid is widely used in various industries. It is a key component in the synthesis of metal chelates, particularly for aluminum and copper complexes. It is also used in the pharmaceutical industry for its complexing properties, in the polymer industry for stabilizers, and in the semiconductor industry for its role in etching processes.

About

CAS No 84-88-8
English Name 8-Hydroxyquinoline-5-sulfonic acid
Molecular Formula C9H7NO4S
Molecular Weight 225.22 g/mol
SMILES C1=CC2=C(C=CC(=C2N=C1)O)S(=O)(=O)O
InChIKey LGDFHDKSYGVKDC-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 8-Hydroxyquinoline-5-sulfonic acid (CAS: 84-88-8)?

8-Hydroxyquinoline-5-sulfonic acid (CAS: 84-88-8) is a crystalline compound with a molecular weight ...

Compound Q&A

How is 8-Hydroxyquinoline-5-sulfonic acid (CAS: 84-88-8) typically synthesized?

8-Hydroxyquinoline-5-sulfonic acid is typically synthesized from 8-hydroxyquinoline through sulfonat...

Compound Q&A

What precautions should be taken when handling 8-Hydroxyquinoline-5-sulfonic acid (CAS: 84-88-8)?

When handling 8-Hydroxyquinoline-5-sulfonic acid (CAS: 84-88-8), it is essential to use personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...