Compound Q&A

How is 8-Hydroxyquinoline-5-sulfonic acid (CAS: 84-88-8) typically synthesized?

Answer

8-Hydroxyquinoline-5-sulfonic acid
8-Hydroxyquinoline-5-sulfonic acid is typically synthesized from 8-hydroxyquinoline through sulfonation reactions. Common methods include direct sulfonation with concentrated sulfuric acid or mixed acid catalysts. The reaction is selective and yields up to 95% of the product.

About

CAS No 84-88-8
English Name 8-Hydroxyquinoline-5-sulfonic acid
Molecular Formula C9H7NO4S
Molecular Weight 225.22 g/mol
SMILES C1=CC2=C(C=CC(=C2N=C1)O)S(=O)(=O)O
InChIKey LGDFHDKSYGVKDC-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 8-Hydroxyquinoline-5-sulfonic acid (CAS: 84-88-8)?

8-Hydroxyquinoline-5-sulfonic acid (CAS: 84-88-8) is a crystalline compound with a molecular weight ...

Compound Q&A

What industries use 8-Hydroxyquinoline-5-sulfonic acid (CAS: 84-88-8)?

8-Hydroxyquinoline-5-sulfonic acid is widely used in various industries. It is a key component in th...

Compound Q&A

What precautions should be taken when handling 8-Hydroxyquinoline-5-sulfonic acid (CAS: 84-88-8)?

When handling 8-Hydroxyquinoline-5-sulfonic acid (CAS: 84-88-8), it is essential to use personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...