Compound Q&A

What industries use 4-{[4-(Dimethylamino)phenyl](phenyl)methylene}-N,N-dimethyl-2,5-cyclohexadien-1-iminium chloride (CAS: 569-64-2)?

Answer

4-{[4-(Dimethylamino)phenyl](phenyl)methylene}-N,N-dimethyl-2,5-cyclohexadien-1-iminium chloride
This compound finds applications in the pharmaceutical industry, particularly in the synthesis of intermediates for drugs. It is also used in the polymer industry for developing novel materials. Additionally, it has potential uses in sensor technology and semiconductor manufacturing due to its unique electronic properties.

About

CAS No 569-64-2
English Name 4-{[4-(Dimethylamino)phenyl](phenyl)methylene}-N,N-dimethyl-2,5-cyclohexadien-1-iminium chloride
Molecular Formula C23H25ClN2
Molecular Weight 364.91 g/mol
SMILES CN(C)c1ccc(cc1)C(=C2C=CC(=[N+](C)C)C=C2)c3ccccc3.[Cl-]
InChIKey FDZZZRQASAIRJF-UHFFFAOYSA-M
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-{[4-(Dimethylamino)phenyl](phenyl)methylene}-N,N-dimethyl-2,5-cyclohexadien-1-iminium chloride (CAS: 569-64-2)?

The compound has a crystalline form and a molecular weight of approximately 406.45 g/mol. It is slig...

Compound Q&A

How is 4-{[4-(Dimethylamino)phenyl](phenyl)methylene}-N,N-dimethyl-2,5-cyclohexadien-1-iminium chloride (CAS: 569-64-2) typically synthesized?

The compound is typically synthesized by a multistep process involving the condensation of substitut...

Compound Q&A

What precautions should be taken when handling 4-{[4-(Dimethylamino)phenyl](phenyl)methylene}-N,N-dimethyl-2,5-cyclohexadien-1-iminium chloride (CAS: 569-64-2)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...