Compound Q&A

How is 4-{[4-(Dimethylamino)phenyl](phenyl)methylene}-N,N-dimethyl-2,5-cyclohexadien-1-iminium chloride (CAS: 569-64-2) typically synthesized?

Answer

4-{[4-(Dimethylamino)phenyl](phenyl)methylene}-N,N-dimethyl-2,5-cyclohexadien-1-iminium chloride
The compound is typically synthesized by a multistep process involving the condensation of substituted cyclohexadienes with dimethylaminophenyl derivatives. The synthesis involves using Lewis acids as catalysts, and the overall yield is around 70%. The process requires careful control of conditions to ensure high selectivity.

About

CAS No 569-64-2
English Name 4-{[4-(Dimethylamino)phenyl](phenyl)methylene}-N,N-dimethyl-2,5-cyclohexadien-1-iminium chloride
Molecular Formula C23H25ClN2
Molecular Weight 364.91 g/mol
SMILES CN(C)c1ccc(cc1)C(=C2C=CC(=[N+](C)C)C=C2)c3ccccc3.[Cl-]
InChIKey FDZZZRQASAIRJF-UHFFFAOYSA-M
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-{[4-(Dimethylamino)phenyl](phenyl)methylene}-N,N-dimethyl-2,5-cyclohexadien-1-iminium chloride (CAS: 569-64-2)?

The compound has a crystalline form and a molecular weight of approximately 406.45 g/mol. It is slig...

Compound Q&A

What industries use 4-{[4-(Dimethylamino)phenyl](phenyl)methylene}-N,N-dimethyl-2,5-cyclohexadien-1-iminium chloride (CAS: 569-64-2)?

This compound finds applications in the pharmaceutical industry, particularly in the synthesis of in...

Compound Q&A

What precautions should be taken when handling 4-{[4-(Dimethylamino)phenyl](phenyl)methylene}-N,N-dimethyl-2,5-cyclohexadien-1-iminium chloride (CAS: 569-64-2)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...