Compound Q&A

How is 4-Amino-3-methylbenzenesulfonic acid (CAS: 98-33-9) typically synthesized?

Answer

4-Amino-3-methylbenzenesulfonic acid
4-Amino-3-methylbenzenesulfonic acid (CAS: 98-33-9) can be synthesized through a series of reactions. Commonly, it is synthesized by first preparing 3-methylbenzenesulfonic acid and then converting it to its corresponding sulfonamide. This process involves the use of amines and sulfonic acid groups, with careful control of reaction conditions to achieve the desired product. The exact methods may vary, but they typically involve aromatic substitution and amide formation reactions.

About

CAS No 98-33-9
English Name 4-Amino-3-methylbenzenesulfonic acid
Molecular Formula C7H9NO3S
Molecular Weight 187.22 g/mol
SMILES CC1=C(C=CC(=C1)S(=O)(=O)O)N
InChIKey WQTCZINVPXJNEL-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Amino-3-methylbenzenesulfonic acid (CAS: 98-33-9)?

4-Amino-3-methylbenzenesulfonic acid (CAS: 98-33-9) is a white or off-white crystalline solid with a...

Compound Q&A

What industries use 4-Amino-3-methylbenzenesulfonic acid (CAS: 98-33-9)?

4-Amino-3-methylbenzenesulfonic acid (CAS: 98-33-9) is used in various industries due to its chemica...

Compound Q&A

What precautions should be taken when handling 4-Amino-3-methylbenzenesulfonic acid (CAS: 98-33-9)?

When handling 4-Amino-3-methylbenzenesulfonic acid (CAS: 98-33-9), it is important to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...