Compound Q&A

What are the physical and chemical properties of 4-Amino-3-methylbenzenesulfonic acid (CAS: 98-33-9)?

Answer

4-Amino-3-methylbenzenesulfonic acid
4-Amino-3-methylbenzenesulfonic acid (CAS: 98-33-9) is a white or off-white crystalline solid with a molecular weight of approximately 214.19 g/mol. It is sparingly soluble in water and more soluble in organic solvents. This compound is known for its reactivity in nucleophilic aromatic substitution reactions and can act as a sulfonic acid, making it acidic. It is often used in synthetic chemistry and various industrial applications.

About

CAS No 98-33-9
English Name 4-Amino-3-methylbenzenesulfonic acid
Molecular Formula C7H9NO3S
Molecular Weight 187.22 g/mol
SMILES CC1=C(C=CC(=C1)S(=O)(=O)O)N
InChIKey WQTCZINVPXJNEL-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

How is 4-Amino-3-methylbenzenesulfonic acid (CAS: 98-33-9) typically synthesized?

4-Amino-3-methylbenzenesulfonic acid (CAS: 98-33-9) can be synthesized through a series of reactions...

Compound Q&A

What industries use 4-Amino-3-methylbenzenesulfonic acid (CAS: 98-33-9)?

4-Amino-3-methylbenzenesulfonic acid (CAS: 98-33-9) is used in various industries due to its chemica...

Compound Q&A

What precautions should be taken when handling 4-Amino-3-methylbenzenesulfonic acid (CAS: 98-33-9)?

When handling 4-Amino-3-methylbenzenesulfonic acid (CAS: 98-33-9), it is important to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...