Compound Q&A

How is 7-Methoxy-4-oxo-1,4-dihydro-6-quinazolinyl acetate (CAS: 179688-53-0) typically synthesized?

Answer

7-Methoxy-4-oxo-1,4-dihydro-6-quinazolinyl acetate
7-Methoxy-4-oxo-1,4-dihydro-6-quinazolinyl acetate is typically synthesized by the acetylation of 7-methoxy-4-oxo-1,4-dihydro-6-quinazoline with acetic anhydride in the presence of a catalytic amount of p-toluenesulfonic acid. The reaction is carried out under reflux conditions leading to high yield and selectivity. The product is usually purified by recrystallization from a suitable solvent.

About

English Name 7-Methoxy-4-oxo-1,4-dihydro-6-quinazolinyl acetate
Molecular Formula C11H10N2O4
Molecular Weight 234.21 g/mol
SMILES CC(=O)OC1=C(C=C2C(=C1)C(=O)NC=N2)OC
InChIKey SOLQIFINSOHAQD-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Methoxy-4-oxo-1,4-dihydro-6-quinazolinyl acetate (CAS: 179688-53-0)?

7-Methoxy-4-oxo-1,4-dihydro-6-quinazolinyl acetate (CAS: 179688-53-0) is a crystalline compound with...

Compound Q&A

What industries use 7-Methoxy-4-oxo-1,4-dihydro-6-quinazolinyl acetate (CAS: 179688-53-0)?

7-Methoxy-4-oxo-1,4-dihydro-6-quinazolinyl acetate (CAS: 179688-53-0) finds application in the pharm...

Compound Q&A

What precautions should be taken when handling 7-Methoxy-4-oxo-1,4-dihydro-6-quinazolinyl acetate (CAS: 179688-53-0)?

When handling 7-Methoxy-4-oxo-1,4-dihydro-6-quinazolinyl acetate (CAS: 179688-53-0), it is important...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...