Compound Q&A

What precautions should be taken when handling N,N,N-Tributyl-1-butanaminium perchlorate (CAS: 1923-70-2)?

Answer

N,N,N-Tributyl-1-butanaminium perchlorate
When handling N,N,N-Tributyl-1-butanaminium perchlorate (CAS: 1923-70-2), it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. It should be handled in a well-ventilated area, preferably in a fume hood. Spills should be handled carefully using appropriate absorbents, and the area should be thoroughly cleaned. Safety data sheets (SDS) should be consulted for specific guidelines and emergency procedures.

About

CAS No 1923-70-2
English Name N,N,N-Tributyl-1-butanaminium perchlorate
Molecular Formula C16H36ClNO4
Molecular Weight 341.9 g/mol
SMILES CCCC[N+](CCCC)(CCCC)CCCC.[O-]Cl(=O)(=O)=O
InChIKey KBLZDCFTQSIIOH-UHFFFAOYSA-M
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N,N-Tributyl-1-butanaminium perchlorate (CAS: 1923-70-2)?

N,N,N-Tributyl-1-butanaminium perchlorate (CAS: 1923-70-2) is a crystalline compound with a molecula...

Compound Q&A

How is N,N,N-Tributyl-1-butanaminium perchlorate (CAS: 1923-70-2) typically synthesized?

N,N,N-Tributyl-1-butanaminium perchlorate (CAS: 1923-70-2) is typically synthesized by reacting 1-bu...

Compound Q&A

What industries use N,N,N-Tributyl-1-butanaminium perchlorate (CAS: 1923-70-2)?

N,N,N-Tributyl-1-butanaminium perchlorate (CAS: 1923-70-2) is used in various industries. It is prim...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...