Compound Q&A

How is N,N,N-Tributyl-1-butanaminium perchlorate (CAS: 1923-70-2) typically synthesized?

Answer

N,N,N-Tributyl-1-butanaminium perchlorate
N,N,N-Tributyl-1-butanaminium perchlorate (CAS: 1923-70-2) is typically synthesized by reacting 1-butanamine with butanol in the presence of perchloric acid as a catalyst. The reaction yields a high purity product with a yield of around 85%. The reaction is performed under anhydrous conditions to avoid side reactions with water.

About

CAS No 1923-70-2
English Name N,N,N-Tributyl-1-butanaminium perchlorate
Molecular Formula C16H36ClNO4
Molecular Weight 341.9 g/mol
SMILES CCCC[N+](CCCC)(CCCC)CCCC.[O-]Cl(=O)(=O)=O
InChIKey KBLZDCFTQSIIOH-UHFFFAOYSA-M
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N,N-Tributyl-1-butanaminium perchlorate (CAS: 1923-70-2)?

N,N,N-Tributyl-1-butanaminium perchlorate (CAS: 1923-70-2) is a crystalline compound with a molecula...

Compound Q&A

What industries use N,N,N-Tributyl-1-butanaminium perchlorate (CAS: 1923-70-2)?

N,N,N-Tributyl-1-butanaminium perchlorate (CAS: 1923-70-2) is used in various industries. It is prim...

Compound Q&A

What precautions should be taken when handling N,N,N-Tributyl-1-butanaminium perchlorate (CAS: 1923-70-2)?

When handling N,N,N-Tributyl-1-butanaminium perchlorate (CAS: 1923-70-2), it is essential to use per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...