Compound Q&A

What industries use 2-Bromo-9,10-anthraquinone (CAS: 572-83-8)?

Answer

2-Bromo-9,10-anthraquinone
2-Bromo-9,10-anthraquinone is primarily used in the pharmaceutical and chemical industries for the synthesis of dyes and intermediates. It is also used in the production of organic semiconductor materials and as a reagent in analytical chemistry. Its applications include dye intermediates, organic electronic materials, and chemical sensors.

About

CAS No 572-83-8
English Name 2-Bromo-9,10-anthraquinone
Molecular Formula C14H7BrO2
Molecular Weight 287.11 g/mol
SMILES C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C=C(C=C3)Br
InChIKey VTSDGYDTWADUJQ-UHFFFAOYSA-N
Last Updated: 2025-09-07 00:47

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromo-9,10-anthraquinone (CAS: 572-83-8)?

2-Bromo-9,10-anthraquinone is a yellow crystalline solid with a molecular formula of C14H8BrO2 and a...

Compound Q&A

How is 2-Bromo-9,10-anthraquinone (CAS: 572-83-8) typically synthesized?

2-Bromo-9,10-anthraquinone is commonly synthesized by the bromination of 9,10-anthraquinone using br...

Compound Q&A

What precautions should be taken when handling 2-Bromo-9,10-anthraquinone (CAS: 572-83-8)?

When handling 2-Bromo-9,10-anthraquinone, appropriate personal protective equipment (PPE) such as gl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...