Compound Q&A

What are the physical and chemical properties of 2-Bromo-9,10-anthraquinone (CAS: 572-83-8)?

Answer

2-Bromo-9,10-anthraquinone
2-Bromo-9,10-anthraquinone is a yellow crystalline solid with a molecular formula of C14H8BrO2 and a molecular weight of approximately 259.05 g/mol. It has a low water solubility and high solubility in organic solvents such as acetone and ethanol. This compound is relatively stable but can undergo bromine substitution reactions under certain conditions. Its crystalline form is typically monoclinic.

About

CAS No 572-83-8
English Name 2-Bromo-9,10-anthraquinone
Molecular Formula C14H7BrO2
Molecular Weight 287.11 g/mol
SMILES C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C=C(C=C3)Br
InChIKey VTSDGYDTWADUJQ-UHFFFAOYSA-N
Last Updated: 2025-09-07 00:47

Related Q&A

Compound Q&A

How is 2-Bromo-9,10-anthraquinone (CAS: 572-83-8) typically synthesized?

2-Bromo-9,10-anthraquinone is commonly synthesized by the bromination of 9,10-anthraquinone using br...

Compound Q&A

What industries use 2-Bromo-9,10-anthraquinone (CAS: 572-83-8)?

2-Bromo-9,10-anthraquinone is primarily used in the pharmaceutical and chemical industries for the s...

Compound Q&A

What precautions should be taken when handling 2-Bromo-9,10-anthraquinone (CAS: 572-83-8)?

When handling 2-Bromo-9,10-anthraquinone, appropriate personal protective equipment (PPE) such as gl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...