Compound Q&A

How should 2-Bromo-6-methoxynaphthalene (CAS: 5111-65-9) be stored?

Answer

2-Bromo-6-methoxynaphthalene (Naproxen Impurity N)
2-Bromo-6-methoxynaphthalene (CAS: 5111-65-9) should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent degradation and ensure purity. Proper storage conditions are crucial to maintain its stability and safety during handling and use.

About

CAS No 5111-65-9
English Name 2-Bromo-6-methoxynaphthalene (Naproxen Impurity N)
Molecular Formula C11H9BrO
Molecular Weight 237.1 g/mol
SMILES COC1=CC2=C(C=C1)C=C(C=C2)Br
InChIKey AYFJBMBVXWNYLT-UHFFFAOYSA-N
Last Updated: 2025-09-07 00:47

Related Q&A

Compound Q&A

What is 2-Bromo-6-methoxynaphthalene (CAS: 5111-65-9)?

2-Bromo-6-methoxynaphthalene (CAS: 5111-65-9) is a chemical compound with the molecular formula C12H...

Compound Q&A

What are the main uses of 2-Bromo-6-methoxynaphthalene (CAS: 5111-65-9)?

2-Bromo-6-methoxynaphthalene (CAS: 5111-65-9) is primarily used as an impurity in the pharmaceutical...

Compound Q&A

Is 2-Bromo-6-methoxynaphthalene (CAS: 5111-65-9) safe?

2-Bromo-6-methoxynaphthalene (CAS: 5111-65-9) is generally considered safe when used under proper ha...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...