Compound Q&A

Are there alternatives to 4-Chlorobenzenesulfonic acid (CAS: 98-66-8) in synthesis?

Answer

4-Chlorobenzenesulfonic acid
Several alternatives to 4-Chlorobenzenesulfonic acid (CAS: 98-66-8) can be used in synthesis, depending on the specific requirements of the reaction. Common alternatives include tosyl chloride and mesyl chloride, which offer similar functionality. Additionally, other sulfonic acids like p-toluenesulfonic acid or benzenesulfonic acid can be substituted based on the reaction conditions and desired product.

About

CAS No 98-66-8
English Name 4-Chlorobenzenesulfonic acid
Molecular Formula C6H5ClO3S
Molecular Weight 192.62 g/mol
SMILES C1=CC(=CC=C1S(=O)(=O)O)Cl
InChIKey RJWBTWIBUIGANW-UHFFFAOYSA-N
Last Updated: 2025-09-06 09:47

Related Q&A

Compound Q&A

What regulatory guidelines apply to 4-Chlorobenzenesulfonic acid (CAS: 98-66-8)?

4-Chlorobenzenesulfonic acid (CAS: 98-66-8) falls under the classification of a hazardous chemical u...

Compound Q&A

What is the market or research trend for 4-Chlorobenzenesulfonic acid (CAS: 98-66-8)?

4-Chlorobenzenesulfonic acid (CAS: 98-66-8) is primarily used in the pharmaceutical, dye-making, and...

Compound Q&A

How should waste containing 4-Chlorobenzenesulfonic acid (CAS: 98-66-8) be handled?

Waste containing 4-Chlorobenzenesulfonic acid (CAS: 98-66-8) should be collected in appropriate cont...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...