Compound Q&A

What precautions should be taken when handling 3,5-Dibromo-4-hydroxybenzaldehyde (CAS: 2973-77-5)?

Answer

3,5-Dibromo-4-hydroxybenzaldehyde
When handling 3,5-Dibromo-4-hydroxybenzaldehyde (CAS: 2973-77-5), it is essential to wear proper personal protective equipment (PPE) including gloves, goggles, and a lab coat. This compound should be used in a well-ventilated area or a fume hood to minimize inhalation risks. In case of spills, the area should be carefully cleaned up with appropriate absorbents. Always refer to the Material Safety Data Sheet (MSDS/SDS) for detailed safety information and emergency procedures.

About

CAS No 2973-77-5
English Name 3,5-Dibromo-4-hydroxybenzaldehyde
Molecular Formula C7H4Br2O2
Molecular Weight 279.91 g/mol
SMILES C1=C(C=C(C(=C1Br)O)Br)C=O
InChIKey SXRHGLQCOLNZPT-UHFFFAOYSA-N
Last Updated: 2025-09-05 20:45

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,5-Dibromo-4-hydroxybenzaldehyde (CAS: 2973-77-5)?

3,5-Dibromo-4-hydroxybenzaldehyde (CAS: 2973-77-5) is a crystalline compound. Its molecular weight i...

Compound Q&A

How is 3,5-Dibromo-4-hydroxybenzaldehyde (CAS: 2973-77-5) typically synthesized?

3,5-Dibromo-4-hydroxybenzaldehyde (CAS: 2973-77-5) can be synthesized through the bromination of 4-h...

Compound Q&A

What industries use 3,5-Dibromo-4-hydroxybenzaldehyde (CAS: 2973-77-5)?

3,5-Dibromo-4-hydroxybenzaldehyde (CAS: 2973-77-5) is used across various industries. It finds appli...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...