Compound Q&A

How is 3,5-Dibromo-4-hydroxybenzaldehyde (CAS: 2973-77-5) typically synthesized?

Answer

3,5-Dibromo-4-hydroxybenzaldehyde
3,5-Dibromo-4-hydroxybenzaldehyde (CAS: 2973-77-5) can be synthesized through the bromination of 4-hydroxybenzaldehyde followed by a selective reduction. Commonly, this involves the use of bromine in the presence of anhydrous hydrogen bromide or bromine and zinc powder. The reaction is typically carried out under anhydrous conditions to prevent side reactions. The yield is usually around 65-75%, and the product can be purified by recrystallization from ethanol.

About

CAS No 2973-77-5
English Name 3,5-Dibromo-4-hydroxybenzaldehyde
Molecular Formula C7H4Br2O2
Molecular Weight 279.91 g/mol
SMILES C1=C(C=C(C(=C1Br)O)Br)C=O
InChIKey SXRHGLQCOLNZPT-UHFFFAOYSA-N
Last Updated: 2025-09-05 20:45

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,5-Dibromo-4-hydroxybenzaldehyde (CAS: 2973-77-5)?

3,5-Dibromo-4-hydroxybenzaldehyde (CAS: 2973-77-5) is a crystalline compound. Its molecular weight i...

Compound Q&A

What industries use 3,5-Dibromo-4-hydroxybenzaldehyde (CAS: 2973-77-5)?

3,5-Dibromo-4-hydroxybenzaldehyde (CAS: 2973-77-5) is used across various industries. It finds appli...

Compound Q&A

What precautions should be taken when handling 3,5-Dibromo-4-hydroxybenzaldehyde (CAS: 2973-77-5)?

When handling 3,5-Dibromo-4-hydroxybenzaldehyde (CAS: 2973-77-5), it is essential to wear proper per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...