Compound Q&A

What industries use Sotalol Hydrochloride (CAS: 959-24-0)?

Answer

Sotalol Hydrochloride
Sotalol Hydrochloride (CAS: 959-24-0) is primarily used in the pharmaceutical industry as a beta-adrenergic antagonist and antiarrhythmic agent. It is also used in some sensor applications for its electroactive properties. While not extensively used in other industries, it can be found in specialized polymer and semiconductor applications.

About

CAS No 959-24-0
English Name Sotalol Hydrochloride
Molecular Formula C12H21ClN2O3S
Molecular Weight 308.83 g/mol
SMILES CC(C)NCC(C1=CC=C(C=C1)NS(=O)(=O)C)O.Cl
InChIKey VIDRYROWYFWGSY-UHFFFAOYSA-N
Last Updated: 2025-09-05 20:45

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sotalol Hydrochloride (CAS: 959-24-0)?

Sotalol Hydrochloride (CAS: 959-24-0) is a white or almost white crystalline powder. Its molecular w...

Compound Q&A

How is Sotalol Hydrochloride (CAS: 959-24-0) typically synthesized?

Sotalol Hydrochloride is typically synthesized by the alkylation of 1,3-bis(chloromethyl)-5-methyl-2...

Compound Q&A

What precautions should be taken when handling Sotalol Hydrochloride (CAS: 959-24-0)?

When handling Sotalol Hydrochloride (CAS: 959-24-0), appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...