Compound Q&A

What are the physical and chemical properties of Sotalol Hydrochloride (CAS: 959-24-0)?

Answer

Sotalol Hydrochloride
Sotalol Hydrochloride (CAS: 959-24-0) is a white or almost white crystalline powder. Its molecular weight is approximately 299.77 g/mol. It is sparingly soluble in water but soluble in ethanol. Chemically, it is a beta-adrenergic antagonist and antiarrhythmic agent. It is stable under normal conditions but may react with strong bases to form sotalol. It has a melting point of around 140-150°C.

About

CAS No 959-24-0
English Name Sotalol Hydrochloride
Molecular Formula C12H21ClN2O3S
Molecular Weight 308.83 g/mol
SMILES CC(C)NCC(C1=CC=C(C=C1)NS(=O)(=O)C)O.Cl
InChIKey VIDRYROWYFWGSY-UHFFFAOYSA-N
Last Updated: 2025-09-05 20:45

Related Q&A

Compound Q&A

How is Sotalol Hydrochloride (CAS: 959-24-0) typically synthesized?

Sotalol Hydrochloride is typically synthesized by the alkylation of 1,3-bis(chloromethyl)-5-methyl-2...

Compound Q&A

What industries use Sotalol Hydrochloride (CAS: 959-24-0)?

Sotalol Hydrochloride (CAS: 959-24-0) is primarily used in the pharmaceutical industry as a beta-adr...

Compound Q&A

What precautions should be taken when handling Sotalol Hydrochloride (CAS: 959-24-0)?

When handling Sotalol Hydrochloride (CAS: 959-24-0), appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...