Compound Q&A

How is Navitoclax (CAS: 923564-51-6) typically synthesized?

Answer

Navitoclax
Navitoclax is typically synthesized through a multi-step organic synthesis route. The key steps involve the protection of the hydroxyl groups, formation of the amide bond, and subsequent deprotection. Common catalysts used include TBTU and HATU, and the synthetic method is highly selective, yielding around 80-85% purity. The process is optimized for efficiency and scalability.

About

English Name Navitoclax
Molecular Formula C47H55ClF3N5O6S3
Molecular Weight 974.6339999999994 g/mol
SMILES CC1(CCC(=C(C1)CN2CCN(CC2)C3=CC=C(C=C3)C(=O)NS(=O)(=O)C4=CC(=C(C=C4)NC(CCN5CCOCC5)CSC6=CC=CC=C6)S(=O)(=O)C(F)(F)F)C7=CC=C(C=C7)Cl)C
InChIKey JLYAXFNOILIKPP-KXQOOQHDSA-N
Last Updated: 2025-09-05 20:45

Related Q&A

Compound Q&A

What are the physical and chemical properties of Navitoclax (CAS: 923564-51-6)?

Navitoclax is a crystalline compound with a molecular weight of approximately 435.34 g/mol. It has a...

Compound Q&A

What industries use Navitoclax (CAS: 923564-51-6)?

Navitoclax is primarily used in the pharmaceutical industry, particularly in cancer research and tre...

Compound Q&A

What precautions should be taken when handling Navitoclax (CAS: 923564-51-6)?

When handling Navitoclax, it is essential to use appropriate personal protective equipment (PPE) suc...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...