Compound Q&A

What are the physical and chemical properties of Navitoclax (CAS: 923564-51-6)?

Answer

Navitoclax
Navitoclax is a crystalline compound with a molecular weight of approximately 435.34 g/mol. It has a solubility of about 20 mg/mL in DMSO and is poorly soluble in water. Navitoclax is a potent inhibitor of BCL-2 family proteins, which makes it reactive towards these targets. It is stable under normal laboratory conditions but requires careful handling to maintain its activity.

About

English Name Navitoclax
Molecular Formula C47H55ClF3N5O6S3
Molecular Weight 974.63 g/mol
SMILES CC1(CCC(=C(C1)CN2CCN(CC2)C3=CC=C(C=C3)C(=O)NS(=O)(=O)C4=CC(=C(C=C4)NC(CCN5CCOCC5)CSC6=CC=CC=C6)S(=O)(=O)C(F)(F)F)C7=CC=C(C=C7)Cl)C
InChIKey JLYAXFNOILIKPP-KXQOOQHDSA-N
Last Updated: 2025-09-05 20:45

Related Q&A

Compound Q&A

How is Navitoclax (CAS: 923564-51-6) typically synthesized?

Navitoclax is typically synthesized through a multi-step organic synthesis route. The key steps invo...

Compound Q&A

What industries use Navitoclax (CAS: 923564-51-6)?

Navitoclax is primarily used in the pharmaceutical industry, particularly in cancer research and tre...

Compound Q&A

What precautions should be taken when handling Navitoclax (CAS: 923564-51-6)?

When handling Navitoclax, it is essential to use appropriate personal protective equipment (PPE) suc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...