Compound Q&A

What industries use 1-[4-(Trifluoromethoxy)phenyl]ethanone (CAS: 85013-98-5)?

Answer

1-[4-(Trifluoromethoxy)phenyl]ethanone
1-[4-(Trifluoromethoxy)phenyl]ethanone (CAS: 85013-98-5) is used in the pharmaceutical industry for the synthesis of complex organic molecules and as a precursor in the development of novel drugs. It is also relevant in the polymer industry for the formation of functional materials with enhanced properties. Additionally, it finds applications in the field of sensors and semiconductors for its unique chemical properties.

About

CAS No 85013-98-5
English Name 1-[4-(Trifluoromethoxy)phenyl]ethanone
Molecular Formula C9H7F3O2
Molecular Weight 204.14699999999993 g/mol
SMILES CC(=O)c1ccc(cc1)OC(F)(F)F
InChIKey MOEXTBIPPMLEFX-UHFFFAOYSA-N
Last Updated: 2025-09-05 16:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-[4-(Trifluoromethoxy)phenyl]ethanone (CAS: 85013-98-5)?

1-[4-(Trifluoromethoxy)phenyl]ethanone (CAS: 85013-98-5) is a crystalline solid with a molecular wei...

Compound Q&A

How is 1-[4-(Trifluoromethoxy)phenyl]ethanone (CAS: 85013-98-5) typically synthesized?

1-[4-(Trifluoromethoxy)phenyl]ethanone (CAS: 85013-98-5) is commonly synthesized via a Friedel-Craft...

Compound Q&A

What precautions should be taken when handling 1-[4-(Trifluoromethoxy)phenyl]ethanone (CAS: 85013-98-5)?

Proper handling of 1-[4-(Trifluoromethoxy)phenyl]ethanone (CAS: 85013-98-5) is essential due to its ...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...