Compound Q&A

How is 2'-O-Methylcytidine (CAS: 2140-72-9) typically synthesized?

Answer

2'-O-Methylcytidine
2'-O-Methylcytidine (CAS: 2140-72-9) is synthesized through a multi-step process involving alkylation of cytidine with methanol in the presence of a base like sodium hydride. Commonly used catalysts include palladium on carbon, and the reaction is typically carried out under mild conditions. The product is then purified by recrystallization or column chromatography. The yield can range from 50% to 70%, depending on the optimization of the reaction conditions.

About

CAS No 2140-72-9
English Name 2'-O-Methylcytidine
Molecular Formula C10H15N3O5
Molecular Weight 257.25 g/mol
SMILES COC1C(C(OC1N2C=CC(=NC2=O)N)CO)O
InChIKey RFCQJGFZUQFYRF-ZOQUXTDFSA-N
Last Updated: 2025-09-05 16:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2'-O-Methylcytidine (CAS: 2140-72-9)?

2'-O-Methylcytidine (CAS: 2140-72-9) is a water-soluble compound with a molecular weight of approxim...

Compound Q&A

What industries use 2'-O-Methylcytidine (CAS: 2140-72-9)?

2'-O-Methylcytidine (CAS: 2140-72-9) is primarily used in the pharmaceutical industry for the develo...

Compound Q&A

What precautions should be taken when handling 2'-O-Methylcytidine (CAS: 2140-72-9)?

Proper handling of 2'-O-Methylcytidine (CAS: 2140-72-9) requires the use of personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...