Compound Q&A

What are the physical and chemical properties of 2'-O-Methylcytidine (CAS: 2140-72-9)?

Answer

2'-O-Methylcytidine
2'-O-Methylcytidine (CAS: 2140-72-9) is a water-soluble compound with a molecular weight of approximately 266.21 g/mol. It forms a white crystalline powder. This compound is relatively stable under normal conditions but can degrade in acidic or strongly basic environments. It is susceptible to hydrolysis and oxidation. It is soluble in polar solvents such as water, ethanol, and DMSO, and slightly soluble in non-polar solvents like hexane and dichloromethane.

About

CAS No 2140-72-9
English Name 2'-O-Methylcytidine
Molecular Formula C10H15N3O5
Molecular Weight 257.25 g/mol
SMILES COC1C(C(OC1N2C=CC(=NC2=O)N)CO)O
InChIKey RFCQJGFZUQFYRF-ZOQUXTDFSA-N
Last Updated: 2025-09-05 16:09

Related Q&A

Compound Q&A

How is 2'-O-Methylcytidine (CAS: 2140-72-9) typically synthesized?

2'-O-Methylcytidine (CAS: 2140-72-9) is synthesized through a multi-step process involving alkylatio...

Compound Q&A

What industries use 2'-O-Methylcytidine (CAS: 2140-72-9)?

2'-O-Methylcytidine (CAS: 2140-72-9) is primarily used in the pharmaceutical industry for the develo...

Compound Q&A

What precautions should be taken when handling 2'-O-Methylcytidine (CAS: 2140-72-9)?

Proper handling of 2'-O-Methylcytidine (CAS: 2140-72-9) requires the use of personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...