Compound Q&A

What are the main uses of 4,6-Dichloronicotinic acid (CAS: 73027-79-9)?

Answer

4,6-Dichloronicotinic acid
4,6-Dichloronicotinic acid is primarily used in the synthesis of other chemical compounds, such as pharmaceuticals and agrochemicals. It also serves as a reagent in analytical chemistry and as a component in some formulations requiring acidic properties.

About

CAS No 73027-79-9
English Name 4,6-Dichloronicotinic acid
Molecular Formula C6H3Cl2NO2
Molecular Weight 192 g/mol
SMILES C1=C(C(=CN=C1Cl)C(=O)O)Cl
InChIKey ILMIEWNDXAKVNI-UHFFFAOYSA-N
Last Updated: 2025-09-04 23:41

Related Q&A

Compound Q&A

What is 4,6-Dichloronicotinic acid (CAS: 73027-79-9)?

4,6-Dichloronicotinic acid is a white crystalline solid with the chemical formula C5H4Cl2N2O3. It is...

Compound Q&A

Is 4,6-Dichloronicotinic acid (CAS: 73027-79-9) safe?

4,6-Dichloronicotinic acid is generally considered safe for laboratory use when handled with appropr...

Compound Q&A

How should 4,6-Dichloronicotinic acid (CAS: 73027-79-9) be stored?

4,6-Dichloronicotinic acid should be stored in a cool, dry place away from direct sunlight and heat ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...