Compound Q&A

What is 4,6-Dichloronicotinic acid (CAS: 73027-79-9)?

Answer

4,6-Dichloronicotinic acid
4,6-Dichloronicotinic acid is a white crystalline solid with the chemical formula C5H4Cl2N2O3. It is a derivative of nicotinic acid with two chlorine substituents. The compound is characterized by its acidic nature and is used in various applications due to its chemical properties.

About

CAS No 73027-79-9
English Name 4,6-Dichloronicotinic acid
Molecular Formula C6H3Cl2NO2
Molecular Weight 192 g/mol
SMILES C1=C(C(=CN=C1Cl)C(=O)O)Cl
InChIKey ILMIEWNDXAKVNI-UHFFFAOYSA-N
Last Updated: 2025-09-04 23:41

Related Q&A

Compound Q&A

What are the main uses of 4,6-Dichloronicotinic acid (CAS: 73027-79-9)?

4,6-Dichloronicotinic acid is primarily used in the synthesis of other chemical compounds, such as p...

Compound Q&A

Is 4,6-Dichloronicotinic acid (CAS: 73027-79-9) safe?

4,6-Dichloronicotinic acid is generally considered safe for laboratory use when handled with appropr...

Compound Q&A

How should 4,6-Dichloronicotinic acid (CAS: 73027-79-9) be stored?

4,6-Dichloronicotinic acid should be stored in a cool, dry place away from direct sunlight and heat ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...