Compound Q&A

How should Forsythoside B (CAS: 81525-13-5) be stored?

Answer

Forsythoside B
Forsythoside B should be stored in a tightly sealed container at room temperature (15-25°C) and protected from light. It is stable for several months under these conditions. Avoid exposure to high humidity and direct sunlight to prevent degradation.

About

CAS No 81525-13-5
English Name Forsythoside B
Molecular Formula C34H44O19
Molecular Weight 756.71 g/mol
SMILES CC1C(C(C(C(O1)OC2C(C(OC(C2OC(=O)C=CC3=CC(=C(C=C3)O)O)COC4C(C(CO4)(CO)O)O)OCCC5=CC(=C(C=C5)O)O)O)O)O)O
InChIKey JMBINOWGIHWPJI-UNSOMVRXSA-N
Last Updated: 2025-09-04 23:41

Related Q&A

Compound Q&A

What is Forsythoside B (CAS: 81525-13-5)?

Forsythoside B is a flavonoid glycoside found in Forsythia suspensa, a plant commonly used in tradit...

Compound Q&A

What are the main uses of Forsythoside B (CAS: 81525-13-5)?

Forsythoside B is used in pharmaceuticals for its potential anti-inflammatory and antioxidant effect...

Compound Q&A

Is Forsythoside B (CAS: 81525-13-5) safe?

Forsythoside B is generally considered safe, although toxicity studies are limited. Handling should ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...