Compound Q&A

What are the main uses of Forsythoside B (CAS: 81525-13-5)?

Answer

Forsythoside B
Forsythoside B is used in pharmaceuticals for its potential anti-inflammatory and antioxidant effects. It is also utilized in research for studying the mechanisms of inflammation and oxidative stress. Additionally, it has applications in dietary supplements and cosmetics for its health benefits.

About

CAS No 81525-13-5
English Name Forsythoside B
Molecular Formula C34H44O19
Molecular Weight 756.71 g/mol
SMILES CC1C(C(C(C(O1)OC2C(C(OC(C2OC(=O)C=CC3=CC(=C(C=C3)O)O)COC4C(C(CO4)(CO)O)O)OCCC5=CC(=C(C=C5)O)O)O)O)O)O
InChIKey JMBINOWGIHWPJI-UNSOMVRXSA-N
Last Updated: 2025-09-04 23:41

Related Q&A

Compound Q&A

What is Forsythoside B (CAS: 81525-13-5)?

Forsythoside B is a flavonoid glycoside found in Forsythia suspensa, a plant commonly used in tradit...

Compound Q&A

Is Forsythoside B (CAS: 81525-13-5) safe?

Forsythoside B is generally considered safe, although toxicity studies are limited. Handling should ...

Compound Q&A

How should Forsythoside B (CAS: 81525-13-5) be stored?

Forsythoside B should be stored in a tightly sealed container at room temperature (15-25°C) and prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...