Compound Q&A

What is 1,1':3',1''-Terphenyl-5'-ylboronic acid (CAS: 128388-54-5)?

Answer

1,1':3',1''-Terphenyl-5'-ylboronic acid
1,1':3',1''-Terphenyl-5'-ylboronic acid is a boronic acid derivative with the chemical formula C28H23BO3. It is a colorless or white solid, stable under normal conditions, and has a molecular weight of 394.46. This compound is often used in organic synthesis and as a building block for various materials.

About

English Name 1,1':3',1''-Terphenyl-5'-ylboronic acid
Molecular Formula C18H15BO2
Molecular Weight 274.128 g/mol
SMILES B(C1=CC(=CC(=C1)C2=CC=CC=C2)C3=CC=CC=C3)(O)O
InChIKey MRBZYVMZUBUDAX-UHFFFAOYSA-N
Last Updated: 2025-09-04 23:41

Related Q&A

Compound Q&A

What are the main uses of 1,1':3',1''-Terphenyl-5'-ylboronic acid (CAS: 128388-54-5)?

1,1':3',1''-Terphenyl-5'-ylboronic acid is primarily used in organic synthesis as a key intermediate...

Compound Q&A

Is 1,1':3',1''-Terphenyl-5'-ylboronic acid (CAS: 128388-54-5) safe?

1,1':3',1''-Terphenyl-5'-ylboronic acid is considered safe under normal handling conditions. However...

Compound Q&A

How should 1,1':3',1''-Terphenyl-5'-ylboronic acid (CAS: 128388-54-5) be stored?

1,1':3',1''-Terphenyl-5'-ylboronic acid should be stored in a cool, dry, and well-ventilated place. ...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...