Compound Q&A

What are the main uses of 2-(2,5-Diaminophenyl)ethanol sulfate (1:1) (CAS: 93841-25-9)?

Answer

2-(2,5-Diaminophenyl)ethanol sulfate (1:1)
This compound is primarily used in the pharmaceutical industry as an intermediate in the synthesis of certain drugs. It is also utilized in research for its unique chemical properties.

About

CAS No 93841-25-9
English Name 2-(2,5-Diaminophenyl)ethanol sulfate (1:1)
Molecular Formula C8H14N2O5S
Molecular Weight 250.28 g/mol
SMILES OS(=O)(=O)O.OCCc1cc(N)ccc1N
InChIKey VBSLNFWECRRALP-UHFFFAOYSA-N
Last Updated: 2025-09-04 23:41

Related Q&A

Compound Q&A

What is 2-(2,5-Diaminophenyl)ethanol sulfate (1:1) (CAS: 93841-25-9)?

2-(2,5-Diaminophenyl)ethanol sulfate (1:1) is a chemical compound with a sulfate group attached to i...

Compound Q&A

Is 2-(2,5-Diaminophenyl)ethanol sulfate (1:1) (CAS: 93841-25-9) safe?

2-(2,5-Diaminophenyl)ethanol sulfate (1:1) is generally considered safe when handled properly. It is...

Compound Q&A

How should 2-(2,5-Diaminophenyl)ethanol sulfate (1:1) (CAS: 93841-25-9) be stored?

Store at room temperature, protected from light and moisture. Keep the container tightly closed to p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...