Compound Q&A

What is 2-(2,5-Diaminophenyl)ethanol sulfate (1:1) (CAS: 93841-25-9)?

Answer

2-(2,5-Diaminophenyl)ethanol sulfate (1:1)
2-(2,5-Diaminophenyl)ethanol sulfate (1:1) is a chemical compound with a sulfate group attached to its 2-(2,5-diaminophenyl)ethanol structure. It is commonly used in pharmaceutical and research applications due to its specific functional groups.

About

CAS No 93841-25-9
English Name 2-(2,5-Diaminophenyl)ethanol sulfate (1:1)
Molecular Formula C8H14N2O5S
Molecular Weight 250.28 g/mol
SMILES OS(=O)(=O)O.OCCc1cc(N)ccc1N
InChIKey VBSLNFWECRRALP-UHFFFAOYSA-N
Last Updated: 2025-09-04 23:41

Related Q&A

Compound Q&A

What are the main uses of 2-(2,5-Diaminophenyl)ethanol sulfate (1:1) (CAS: 93841-25-9)?

This compound is primarily used in the pharmaceutical industry as an intermediate in the synthesis o...

Compound Q&A

Is 2-(2,5-Diaminophenyl)ethanol sulfate (1:1) (CAS: 93841-25-9) safe?

2-(2,5-Diaminophenyl)ethanol sulfate (1:1) is generally considered safe when handled properly. It is...

Compound Q&A

How should 2-(2,5-Diaminophenyl)ethanol sulfate (1:1) (CAS: 93841-25-9) be stored?

Store at room temperature, protected from light and moisture. Keep the container tightly closed to p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...