Compound Q&A

What are the main uses of (2S)-2-{[(Benzyloxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 5545-52-8)?

Answer

(2S)-2-{[(Benzyloxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid
This compound is primarily used in the synthesis of peptides and proteins. It serves as a protecting group in organic synthesis, helping to control the reactivity of amino groups during chemical reactions. It is also used in pharmaceutical research for drug development and in the production of peptide-based therapeutics.

About

CAS No 5545-52-8
English Name (2S)-2-{[(Benzyloxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid
Molecular Formula C16H21NO6
Molecular Weight 323.35 g/mol
SMILES CC(C)(C)OC(=O)CC(C(=O)O)NC(=O)OCC1=CC=CC=C1
InChIKey HLSLRFBLVZUVIE-LBPRGKRZSA-N
Last Updated: 2025-09-04 23:41

Related Q&A

Compound Q&A

What is (2S)-2-{[(Benzyloxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 5545-52-8)?

(2S)-2-{[(Benzyloxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid, also known as b...

Compound Q&A

Is (2S)-2-{[(Benzyloxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 5545-52-8) safe?

The compound is generally considered safe for laboratory use when handled with standard precautions....

Compound Q&A

How should (2S)-2-{[(Benzyloxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 5545-52-8) be stored?

Store the compound in a cool, dry place, preferably at room temperature, with temperature maintained...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...