Compound Q&A

What is (2S)-2-{[(Benzyloxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 5545-52-8)?

Answer

(2S)-2-{[(Benzyloxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid
(2S)-2-{[(Benzyloxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid, also known as boc-Val-Thp, is a chemical compound used in pharmaceutical and research applications. It is a protected form of valine, with a benzyloxycarbonyl group attached to the amino group and a 2-methyl-2-propanol group on the hydroxyl position.

About

CAS No 5545-52-8
English Name (2S)-2-{[(Benzyloxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid
Molecular Formula C16H21NO6
Molecular Weight 323.35 g/mol
SMILES CC(C)(C)OC(=O)CC(C(=O)O)NC(=O)OCC1=CC=CC=C1
InChIKey HLSLRFBLVZUVIE-LBPRGKRZSA-N
Last Updated: 2025-09-04 23:41

Related Q&A

Compound Q&A

What are the main uses of (2S)-2-{[(Benzyloxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 5545-52-8)?

This compound is primarily used in the synthesis of peptides and proteins. It serves as a protecting...

Compound Q&A

Is (2S)-2-{[(Benzyloxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 5545-52-8) safe?

The compound is generally considered safe for laboratory use when handled with standard precautions....

Compound Q&A

How should (2S)-2-{[(Benzyloxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 5545-52-8) be stored?

Store the compound in a cool, dry place, preferably at room temperature, with temperature maintained...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...