Compound Q&A

Is 9-([1,1'-Biphenyl]-4-yl)-3-bromo-9H-carbazole (CAS: 894791-46-9) safe?

Answer

9-([1,1'-Biphenyl]-4-yl)-3-bromo-9H-carbazole
9-([1,1'-Biphenyl]-4-yl)-3-bromo-9H-carbazole is generally considered safe for industrial use when handled properly. However, it is toxic if ingested or inhaled. Wear protective clothing, gloves, and goggles during handling. Follow safety guidelines and use in a well-ventilated area.

About

English Name 9-([1,1'-Biphenyl]-4-yl)-3-bromo-9H-carbazole
Molecular Formula C24H16BrN
Molecular Weight 398.3 g/mol
SMILES C1=CC=C(C=C1)C2=CC=C(C=C2)N3C4=C(C=C(C=C4)Br)C5=CC=CC=C53
InChIKey MOCNGNGLTRMQQH-UHFFFAOYSA-N
Last Updated: 2025-09-03 20:19

Related Q&A

Compound Q&A

What is 9-([1,1'-Biphenyl]-4-yl)-3-bromo-9H-carbazole (CAS: 894791-46-9)?

9-([1,1'-Biphenyl]-4-yl)-3-bromo-9H-carbazole is a nitrogen-containing aromatic heterocyclic compoun...

Compound Q&A

What are the main uses of 9-([1,1'-Biphenyl]-4-yl)-3-bromo-9H-carbazole (CAS: 894791-46-9)?

9-([1,1'-Biphenyl]-4-yl)-3-bromo-9H-carbazole is primarily used in the synthesis of various carbazol...

Compound Q&A

How should 9-([1,1'-Biphenyl]-4-yl)-3-bromo-9H-carbazole (CAS: 894791-46-9) be stored?

Store 9-([1,1'-Biphenyl]-4-yl)-3-bromo-9H-carbazole in a cool, dry, and shaded place. Keep container...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...