Compound Q&A

What is 9-([1,1'-Biphenyl]-4-yl)-3-bromo-9H-carbazole (CAS: 894791-46-9)?

Answer

9-([1,1'-Biphenyl]-4-yl)-3-bromo-9H-carbazole
9-([1,1'-Biphenyl]-4-yl)-3-bromo-9H-carbazole is a nitrogen-containing aromatic heterocyclic compound characterized by its carbazole core with a 4-phenyl group attached at position 9 and a bromine atom at position 3. It has a molecular formula of C29H19BrN and exhibits properties like solubility in organic solvents.

About

English Name 9-([1,1'-Biphenyl]-4-yl)-3-bromo-9H-carbazole
Molecular Formula C24H16BrN
Molecular Weight 398.3 g/mol
SMILES C1=CC=C(C=C1)C2=CC=C(C=C2)N3C4=C(C=C(C=C4)Br)C5=CC=CC=C53
InChIKey MOCNGNGLTRMQQH-UHFFFAOYSA-N
Last Updated: 2025-09-03 20:19

Related Q&A

Compound Q&A

What are the main uses of 9-([1,1'-Biphenyl]-4-yl)-3-bromo-9H-carbazole (CAS: 894791-46-9)?

9-([1,1'-Biphenyl]-4-yl)-3-bromo-9H-carbazole is primarily used in the synthesis of various carbazol...

Compound Q&A

Is 9-([1,1'-Biphenyl]-4-yl)-3-bromo-9H-carbazole (CAS: 894791-46-9) safe?

9-([1,1'-Biphenyl]-4-yl)-3-bromo-9H-carbazole is generally considered safe for industrial use when h...

Compound Q&A

How should 9-([1,1'-Biphenyl]-4-yl)-3-bromo-9H-carbazole (CAS: 894791-46-9) be stored?

Store 9-([1,1'-Biphenyl]-4-yl)-3-bromo-9H-carbazole in a cool, dry, and shaded place. Keep container...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...