Compound Q&A

How should (2-Fluoro-3-methoxyphenyl)boronic acid (CAS: 352303-67-4) be stored?

Answer

(2-Fluoro-3-methoxyphenyl)boronic acid
(2-Fluoro-3-methoxyphenyl)boronic acid should be stored in a cool, dry place away from direct sunlight and heat sources. Store the compound in a tightly sealed container to prevent moisture absorption. Keep it away from incompatible materials such as strong oxidizers. Avoid exposure to high temperatures and maintain a stable temperature below 30°C to ensure optimal stability and prevent degradation. Store in a secure location, out of reach of children and unauthorized personnel.

About

English Name (2-Fluoro-3-methoxyphenyl)boronic acid
Molecular Formula C7H8BFO3
Molecular Weight 169.95 g/mol
SMILES B(C1=C(C(=CC=C1)OC)F)(O)O
InChIKey JCKZNMSBFBPDPM-UHFFFAOYSA-N
Last Updated: 2025-09-02 18:52

Related Q&A

Compound Q&A

What is (2-Fluoro-3-methoxyphenyl)boronic acid (CAS: 352303-67-4)?

(2-Fluoro-3-methoxyphenyl)boronic acid is a compound with the chemical formula C9H9FO3B. It is an or...

Compound Q&A

What are the main uses of (2-Fluoro-3-methoxyphenyl)boronic acid (CAS: 352303-67-4)?

(2-Fluoro-3-methoxyphenyl)boronic acid is primarily used in the synthesis of various organic compoun...

Compound Q&A

Is (2-Fluoro-3-methoxyphenyl)boronic acid (CAS: 352303-67-4) safe?

(2-Fluoro-3-methoxyphenyl)boronic acid is generally considered safe for most laboratory use when pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...